C36H45N5O5 — CID 142941651
N-[(2S)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(4-methylphenyl)butan-2-yl]-8-hydroxy-8H-[1,3]dioxolo[4,5-g]chromene-6-carboxamide (PubChem CID 142941651) has the molecular formula C36H45N5O5 and a molecular weight of 627.79 g/mol. Its IUPAC name is N-[(2S)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(4-methylphenyl)butan-2-yl]-8-hydroxy-8H-[1,3]dioxolo[4,5-g]chromene-6-carboxamide.
| Compound Name | N-[(2S)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(4-methylphenyl)butan-2-yl]-8-hydroxy-8H-[1,3]dioxolo[4,5-g]chromene-6-carboxamide |
|---|---|
| PubChem CID | 142941651 |
| Molecular Formula | C36H45N5O5 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | N-[(2S)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]-1-(4-methylphenyl)butan-2-yl]-8-hydroxy-8H-[1,3]dioxolo[4,5-g]chromene-6-carboxamide |
| SMILES | Cc1ccc(C[C@@H](CCN2CCC(Cn3cncn3)(C3CCCCC3)CC2)NC(=O)C2=CC(O)c3cc4c(cc3O2)OCO4)cc1 |
| InChI | InChI=1S/C36H45N5O5/c1-25-7-9-26(10-8-25)17-28(39-35(43)34-19-30(42)29-18-32-33(45-24-44-32)20-31(29)46-34)11-14-40-15-12-36(13-16-40,21-41-23-37-22-38-41)27-5-3-2-4-6-27/h7-10,18-20,22-23,27-28,30,42H,2-6,11-17,21,24H2,1H3,(H,39,43)/t28-,30?/m1/s1 |
| InChIKey | PVVPHRIJCACOCK-KFMIKNBQSA-N |
| XLogP | 5.11 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |