C15H23NO2 — CID 142942230
4,4-dimethoxy-1-(3-methylcyclohepta-2,4,6-trien-1-yl)piperidine (PubChem CID 142942230) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4,4-dimethoxy-1-(3-methylcyclohepta-2,4,6-trien-1-yl)piperidine.
| Compound Name | 4,4-dimethoxy-1-(3-methylcyclohepta-2,4,6-trien-1-yl)piperidine |
|---|---|
| PubChem CID | 142942230 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4,4-dimethoxy-1-(3-methylcyclohepta-2,4,6-trien-1-yl)piperidine |
| SMILES | COC1(OC)CCN(C2C=CC=CC(C)=C2)CC1 |
| InChI | InChI=1S/C15H23NO2/c1-13-6-4-5-7-14(12-13)16-10-8-15(17-2,18-3)9-11-16/h4-7,12,14H,8-11H2,1-3H3 |
| InChIKey | OHJMBMJXWARXSE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|