C34H37N6+ — CID 142942305
N-methyl-N-[(E)-[1-[[4-[[[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-1,3-dienyl]amino]methyl]phenyl]methyl]pyridin-1-ium-4-yl]methylideneamino]aniline (PubChem CID 142942305) has the molecular formula C34H37N6+ and a molecular weight of 529.71 g/mol. Its IUPAC name is N-methyl-N-[(E)-[1-[[4-[[[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-1,3-dienyl]amino]methyl]phenyl]methyl]pyridin-1-ium-4-yl]methylideneamino]aniline.
| Compound Name | N-methyl-N-[(E)-[1-[[4-[[[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-1,3-dienyl]amino]methyl]phenyl]methyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 142942305 |
| Molecular Formula | C34H37N6+ |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | N-methyl-N-[(E)-[1-[[4-[[[(1Z,3E)-3-[(E)-[methyl(phenyl)hydrazinylidene]methyl]penta-1,3-dienyl]amino]methyl]phenyl]methyl]pyridin-1-ium-4-yl]methylideneamino]aniline |
| SMILES | C/C=C(\C=C/NCc1ccc(C[n+]2ccc(/C=N/N(C)c3ccccc3)cc2)cc1)/C=N/N(C)c1ccccc1 |
| InChI | InChI=1S/C34H37N6/c1-4-29(26-36-38(2)33-11-7-5-8-12-33)19-22-35-25-30-15-17-32(18-16-30)28-40-23-20-31(21-24-40)27-37-39(3)34-13-9-6-10-14-34/h4-24,26-27,35H,25,28H2,1-3H3/q+1/b22-19-,29-4+,36-26+ |
| InChIKey | GNRMHQKSMNZLHN-LLRNRRIDSA-N |
| XLogP | 6.16 |
| TPSA | 47.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|