About N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one
N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 142942493) has the molecular formula C19H29F3N2OS
and a molecular weight of 390.52 g/mol. Its IUPAC name is N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one |
| PubChem CID | 142942493 |
| Molecular Formula | C19H29F3N2OS |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | CCC.CCCC(C)NC.O=c1cc(C(F)(F)F)c2cc(S)ccc2[nH]1 |
| InChI | InChI=1S/C10H6F3NOS.C6H15N.C3H8/c11-10(12,13)7-4-9(15)14-8-2-1-5(16)3-6(7)8;1-4-5-6(2)7-3;1-3-2/h1-4,16H,(H,14,15);6-7H,4-5H2,1-3H3;3H2,1-2H3 |
| InChIKey | UONTUSFXJBAESI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one?
The IUPAC name of N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one (CID 142942493) is N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one.
What is the SMILES notation for N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one?
The canonical SMILES for N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one is CCC.CCCC(C)NC.O=c1cc(C(F)(F)F)c2cc(S)ccc2[nH]1.
What is the InChIKey of N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one?
The InChIKey is UONTUSFXJBAESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NOS.C6H15N.C3H8/c11-10(12,13)7-4-9(15)14-8-2-1-5(16)3-6(7)8;1-4-5-6(2)7-3;1-3-2/h1-4,16H,(H,14,15);6-7H,4-5H2,1-3H3;3H2,1-2H3.
What are the key properties of N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one?
N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one has a molecular weight of 390.52 g/mol, XLogP of 5.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpentan-2-amine;propane;6-sulfanyl-4-(trifluoromethyl)-1H-quinolin-2-one is sourced from PubChem (CID 142942493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).