About (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol
(E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol (PubChem CID 142942515) has the molecular formula C11H11N3O4
and a molecular weight of 249.23 g/mol. Its IUPAC name is (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol.
Molecular Properties
| Compound Name | (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol |
| PubChem CID | 142942515 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol |
| SMILES | CO.O=C/C=C/c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H7N3O3.CH4O/c14-3-1-2-6-4-7-8(11-5-6)12-10(16)13-9(7)15;1-2/h1-5H,(H2,11,12,13,15,16);2H,1H3/b2-1+; |
| InChIKey | XNWUEBWXNOPZOI-TYYBGVCCSA-N |
| XLogP | -0.57 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol?
The IUPAC name of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol (CID 142942515) is (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol.
What is the SMILES notation for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol?
The canonical SMILES for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol is CO.O=C/C=C/c1cnc2[nH]c(=O)[nH]c(=O)c2c1.
What is the InChIKey of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol?
The InChIKey is XNWUEBWXNOPZOI-TYYBGVCCSA-N. The full InChI is InChI=1S/C10H7N3O3.CH4O/c14-3-1-2-6-4-7-8(11-5-6)12-10(16)13-9(7)15;1-2/h1-5H,(H2,11,12,13,15,16);2H,1H3/b2-1+;.
What are the key properties of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol?
(E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol has a molecular weight of 249.23 g/mol, XLogP of -0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methanol is sourced from PubChem (CID 142942515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).