About 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane
4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane (PubChem CID 142942599) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane.
Molecular Properties
| Compound Name | 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane |
| PubChem CID | 142942599 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane |
| SMILES | CC.CC/C=C\C1=C(C)N(C)CC1 |
| InChI | InChI=1S/C10H17N.C2H6/c1-4-5-6-10-7-8-11(3)9(10)2;1-2/h5-6H,4,7-8H2,1-3H3;1-2H3/b6-5-; |
| InChIKey | OEWPDIZYKNMSNQ-YSMBQZINSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane?
The IUPAC name of 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane (CID 142942599) is 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane.
What is the SMILES notation for 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane?
The canonical SMILES for 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane is CC.CC/C=C\C1=C(C)N(C)CC1.
What is the InChIKey of 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane?
The InChIKey is OEWPDIZYKNMSNQ-YSMBQZINSA-N. The full InChI is InChI=1S/C10H17N.C2H6/c1-4-5-6-10-7-8-11(3)9(10)2;1-2/h5-6H,4,7-8H2,1-3H3;1-2H3/b6-5-;.
What are the key properties of 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane?
4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane has a molecular weight of 181.32 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-but-1-enyl]-1,5-dimethyl-2,3-dihydropyrrole;ethane is sourced from PubChem (CID 142942599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).