C24H27N5O3 — CID 142942886
1-ethyl-4-phenylimidazole;formaldehyde;5-(methylamino)spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 142942886) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-ethyl-4-phenylimidazole;formaldehyde;5-(methylamino)spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 1-ethyl-4-phenylimidazole;formaldehyde;5-(methylamino)spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 142942886 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-ethyl-4-phenylimidazole;formaldehyde;5-(methylamino)spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | C=O.CCn1cnc(-c2ccccc2)c1.CNc1ccc2c(c1)CC1(C2)NC(=O)NC1=O |
| InChI | InChI=1S/C12H13N3O2.C11H12N2.CH2O/c1-13-9-3-2-7-5-12(6-8(7)4-9)10(16)14-11(17)15-12;1-2-13-8-11(12-9-13)10-6-4-3-5-7-10;1-2/h2-4,13H,5-6H2,1H3,(H2,14,15,16,17);3-9H,2H2,1H3;1H2 |
| InChIKey | MPMXAEVNSVLVAC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|