C20H21N3O3 — CID 142942914
5-[(3-methoxy-5-methylphenyl)methylamino]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 142942914) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-[(3-methoxy-5-methylphenyl)methylamino]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 5-[(3-methoxy-5-methylphenyl)methylamino]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 142942914 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[(3-methoxy-5-methylphenyl)methylamino]spiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | COc1cc(C)cc(CNc2ccc3c(c2)CC2(C3)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-12-5-13(7-17(6-12)26-2)11-21-16-4-3-14-9-20(10-15(14)8-16)18(24)22-19(25)23-20/h3-8,21H,9-11H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | MCOAJPIBYWLZKB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|