C41H32I2N6O2S3 — CID 142942995
4-(6-amino-7-iodo-1,3-benzothiazol-2-yl)phenol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine;4-(7-methyl-1,3-benzothiazol-2-yl)aniline (PubChem CID 142942995) has the molecular formula C41H32I2N6O2S3 and a molecular weight of 990.76 g/mol. Its IUPAC name is 4-(6-amino-7-iodo-1,3-benzothiazol-2-yl)phenol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine;4-(7-methyl-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 4-(6-amino-7-iodo-1,3-benzothiazol-2-yl)phenol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine;4-(7-methyl-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 142942995 |
| Molecular Formula | C41H32I2N6O2S3 |
| Molecular Weight | 990.76 g/mol |
| Exact Mass | 989.98 |
| IUPAC Name | 4-(6-amino-7-iodo-1,3-benzothiazol-2-yl)phenol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine;4-(7-methyl-1,3-benzothiazol-2-yl)aniline |
| SMILES | COc1ccc(-c2nc3ccc(N)c(I)c3s2)cc1.Cc1cccc2nc(-c3ccc(N)cc3)sc12.Nc1ccc2nc(-c3ccc(O)cc3)sc2c1I |
| InChI | InChI=1S/C14H11IN2OS.C14H12N2S.C13H9IN2OS/c1-18-9-4-2-8(3-5-9)14-17-11-7-6-10(16)12(15)13(11)19-14;1-9-3-2-4-12-13(9)17-14(16-12)10-5-7-11(15)8-6-10;14-11-9(15)5-6-10-12(11)18-13(16-10)7-1-3-8(17)4-2-7/h2-7H,16H2,1H3;2-8H,15H2,1H3;1-6,17H,15H2 |
| InChIKey | OAESUYPEYPNRNG-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 146.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.76 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|