About 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine
2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine (PubChem CID 142943251) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine.
Analyze 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine?
The IUPAC name of 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine (CID 142943251) is 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine.
What is the SMILES notation for 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine?
The canonical SMILES for 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine is CC1=NC2=C(CCCCN2)CC1.
What is the InChIKey of 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine?
The InChIKey is DWIYSCRQMNWVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-8-5-6-9-4-2-3-7-11-10(9)12-8/h11H,2-7H2,1H3.
What are the key properties of 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine?
2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine has a molecular weight of 164.25 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7,8,9-hexahydro-3H-pyrido[2,3-b]azepine is sourced from PubChem (CID 142943251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).