About 3-methylcyclohexa-2,4-diene-1-carboximidamide
3-methylcyclohexa-2,4-diene-1-carboximidamide (PubChem CID 142943316) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-methylcyclohexa-2,4-diene-1-carboximidamide.
Molecular Properties
| Compound Name | 3-methylcyclohexa-2,4-diene-1-carboximidamide |
| PubChem CID | 142943316 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3-methylcyclohexa-2,4-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1C=C(C)C=CC1 |
| InChI | InChI=1S/C8H12N2/c1-6-3-2-4-7(5-6)8(9)10/h2-3,5,7H,4H2,1H3,(H3,9,10) |
| InChIKey | KHPKREZWNMIRJA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylcyclohexa-2,4-diene-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclohexa-2,4-diene-1-carboximidamide?
The IUPAC name of 3-methylcyclohexa-2,4-diene-1-carboximidamide (CID 142943316) is 3-methylcyclohexa-2,4-diene-1-carboximidamide.
What is the SMILES notation for 3-methylcyclohexa-2,4-diene-1-carboximidamide?
The canonical SMILES for 3-methylcyclohexa-2,4-diene-1-carboximidamide is [H]/N=C(\N)C1C=C(C)C=CC1.
What is the InChIKey of 3-methylcyclohexa-2,4-diene-1-carboximidamide?
The InChIKey is KHPKREZWNMIRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-3-2-4-7(5-6)8(9)10/h2-3,5,7H,4H2,1H3,(H3,9,10).
What are the key properties of 3-methylcyclohexa-2,4-diene-1-carboximidamide?
3-methylcyclohexa-2,4-diene-1-carboximidamide has a molecular weight of 136.20 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclohexa-2,4-diene-1-carboximidamide is sourced from PubChem (CID 142943316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).