C26H31N5O4S — CID 142943321
N-[2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)benzoyl]amino]cyclohexyl]-1H-indole-6-carboxamide (PubChem CID 142943321) has the molecular formula C26H31N5O4S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-[2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)benzoyl]amino]cyclohexyl]-1H-indole-6-carboxamide.
| Compound Name | N-[2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)benzoyl]amino]cyclohexyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 142943321 |
| Molecular Formula | C26H31N5O4S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)benzoyl]amino]cyclohexyl]-1H-indole-6-carboxamide |
| SMILES | CN(C)C(=NS(C)(=O)=O)c1ccc(C(=O)NC2CCCCC2NC(=O)c2ccc3cc[nH]c3c2)cc1 |
| InChI | InChI=1S/C26H31N5O4S/c1-31(2)24(30-36(3,34)35)18-9-11-19(12-10-18)25(32)28-21-6-4-5-7-22(21)29-26(33)20-13-8-17-14-15-27-23(17)16-20/h8-16,21-22,27H,4-7H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | HPFANTIZQJMBOO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|