About ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide
ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide (PubChem CID 142943368) has the molecular formula C8H19N3O2S
and a molecular weight of 221.33 g/mol. Its IUPAC name is ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide |
| PubChem CID | 142943368 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide |
| SMILES | CC.CN1CCCN=C1NS(C)(=O)=O |
| InChI | InChI=1S/C6H13N3O2S.C2H6/c1-9-5-3-4-7-6(9)8-12(2,10)11;1-2/h3-5H2,1-2H3,(H,7,8);1-2H3 |
| InChIKey | JJMIWCLNMAZKQN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide?
The IUPAC name of ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide (CID 142943368) is ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide.
What is the SMILES notation for ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide?
The canonical SMILES for ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide is CC.CN1CCCN=C1NS(C)(=O)=O.
What is the InChIKey of ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide?
The InChIKey is JJMIWCLNMAZKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2S.C2H6/c1-9-5-3-4-7-6(9)8-12(2,10)11;1-2/h3-5H2,1-2H3,(H,7,8);1-2H3.
What are the key properties of ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide?
ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide has a molecular weight of 221.33 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanesulfonamide is sourced from PubChem (CID 142943368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).