C15H20O2 — CID 142943692
(9Z)-6-hydroxy-3,5,8-trimethylidenedodeca-9,11-dien-2-one (PubChem CID 142943692) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (9Z)-6-hydroxy-3,5,8-trimethylidenedodeca-9,11-dien-2-one.
| Compound Name | (9Z)-6-hydroxy-3,5,8-trimethylidenedodeca-9,11-dien-2-one |
|---|---|
| PubChem CID | 142943692 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (9Z)-6-hydroxy-3,5,8-trimethylidenedodeca-9,11-dien-2-one |
| SMILES | C=C/C=C\C(=C)CC(O)C(=C)CC(=C)C(C)=O |
| InChI | InChI=1S/C15H20O2/c1-6-7-8-11(2)9-15(17)13(4)10-12(3)14(5)16/h6-8,15,17H,1-4,9-10H2,5H3/b8-7- |
| InChIKey | CRKBXCSBURBYON-FPLPWBNLSA-N |
| XLogP | 3.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|