About 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal
6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal (PubChem CID 142943888) has the molecular formula C14H18F3N3O2
and a molecular weight of 317.31 g/mol. Its IUPAC name is 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal.
Molecular Properties
| Compound Name | 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal |
| PubChem CID | 142943888 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal |
| SMILES | Cn1nc(C(F)(F)F)c2c1C(=O)N(CCCCCC=O)CC2 |
| InChI | InChI=1S/C14H18F3N3O2/c1-19-11-10(12(18-19)14(15,16)17)6-8-20(13(11)22)7-4-2-3-5-9-21/h9H,2-8H2,1H3 |
| InChIKey | POTVRQHBNMTIHJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal?
The IUPAC name of 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal (CID 142943888) is 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal.
What is the SMILES notation for 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal?
The canonical SMILES for 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal is Cn1nc(C(F)(F)F)c2c1C(=O)N(CCCCCC=O)CC2.
What is the InChIKey of 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal?
The InChIKey is POTVRQHBNMTIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N3O2/c1-19-11-10(12(18-19)14(15,16)17)6-8-20(13(11)22)7-4-2-3-5-9-21/h9H,2-8H2,1H3.
What are the key properties of 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal?
6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal has a molecular weight of 317.31 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-methyl-7-oxo-3-(trifluoromethyl)-4,5-dihydropyrazolo[5,4-c]pyridin-6-yl]hexanal is sourced from PubChem (CID 142943888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).