C22H24F6N6O3S2 — CID 142944038
4-[[4-[4-[(2E,4E,6E)-1,1,1-trifluoro-2-methyl-6-(trifluoromethyl)octa-2,4,6-trien-4-yl]sulfonylpiperazin-1-yl]-1,2,5-thiadiazol-3-yl]oxymethyl]pyridin-2-amine (PubChem CID 142944038) has the molecular formula C22H24F6N6O3S2 and a molecular weight of 598.60 g/mol. Its IUPAC name is 4-[[4-[4-[(2E,4E,6E)-1,1,1-trifluoro-2-methyl-6-(trifluoromethyl)octa-2,4,6-trien-4-yl]sulfonylpiperazin-1-yl]-1,2,5-thiadiazol-3-yl]oxymethyl]pyridin-2-amine.
| Compound Name | 4-[[4-[4-[(2E,4E,6E)-1,1,1-trifluoro-2-methyl-6-(trifluoromethyl)octa-2,4,6-trien-4-yl]sulfonylpiperazin-1-yl]-1,2,5-thiadiazol-3-yl]oxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 142944038 |
| Molecular Formula | C22H24F6N6O3S2 |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 4-[[4-[4-[(2E,4E,6E)-1,1,1-trifluoro-2-methyl-6-(trifluoromethyl)octa-2,4,6-trien-4-yl]sulfonylpiperazin-1-yl]-1,2,5-thiadiazol-3-yl]oxymethyl]pyridin-2-amine |
| SMILES | C/C=C(\C=C(/C=C(\C)C(F)(F)F)S(=O)(=O)N1CCN(c2nsnc2OCc2ccnc(N)c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C22H24F6N6O3S2/c1-3-16(22(26,27)28)12-17(10-14(2)21(23,24)25)39(35,36)34-8-6-33(7-9-34)19-20(32-38-31-19)37-13-15-4-5-30-18(29)11-15/h3-5,10-12H,6-9,13H2,1-2H3,(H2,29,30)/b14-10+,16-3+,17-12+ |
| InChIKey | HIWLICWXKHPAOF-FORNPOPTSA-N |
| XLogP | 4.45 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|