About 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]
6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] (PubChem CID 142944281) has the molecular formula C20H26N2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] |
| PubChem CID | 142944281 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] |
| SMILES | CCCC1CCC2(CC1)Nc1cccc3c(C)ccc(c13)N2 |
| InChI | InChI=1S/C20H26N2/c1-3-5-15-10-12-20(13-11-15)21-17-7-4-6-16-14(2)8-9-18(22-20)19(16)17/h4,6-9,15,21-22H,3,5,10-13H2,1-2H3 |
| InChIKey | IUCMWCBDYPMHBE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The IUPAC name of 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] (CID 142944281) is 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane].
What is the SMILES notation for 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The canonical SMILES for 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] is CCCC1CCC2(CC1)Nc1cccc3c(C)ccc(c13)N2.
What is the InChIKey of 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
The InChIKey is IUCMWCBDYPMHBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2/c1-3-5-15-10-12-20(13-11-15)21-17-7-4-6-16-14(2)8-9-18(22-20)19(16)17/h4,6-9,15,21-22H,3,5,10-13H2,1-2H3.
What are the key properties of 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane]?
6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] has a molecular weight of 294.44 g/mol, XLogP of 5.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4'-propylspiro[1,3-dihydroperimidine-2,1'-cyclohexane] is sourced from PubChem (CID 142944281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).