About N-ethylethanamine;3-methylbenzenethiol
N-ethylethanamine;3-methylbenzenethiol (PubChem CID 142944401) has the molecular formula C11H19NS
and a molecular weight of 197.35 g/mol. Its IUPAC name is N-ethylethanamine;3-methylbenzenethiol.
Molecular Properties
| Compound Name | N-ethylethanamine;3-methylbenzenethiol |
| PubChem CID | 142944401 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-ethylethanamine;3-methylbenzenethiol |
| SMILES | CCNCC.Cc1cccc(S)c1 |
| InChI | InChI=1S/C7H8S.C4H11N/c1-6-3-2-4-7(8)5-6;1-3-5-4-2/h2-5,8H,1H3;5H,3-4H2,1-2H3 |
| InChIKey | SNFITMINNLMAST-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;3-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;3-methylbenzenethiol?
The IUPAC name of N-ethylethanamine;3-methylbenzenethiol (CID 142944401) is N-ethylethanamine;3-methylbenzenethiol.
What is the SMILES notation for N-ethylethanamine;3-methylbenzenethiol?
The canonical SMILES for N-ethylethanamine;3-methylbenzenethiol is CCNCC.Cc1cccc(S)c1.
What is the InChIKey of N-ethylethanamine;3-methylbenzenethiol?
The InChIKey is SNFITMINNLMAST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C4H11N/c1-6-3-2-4-7(8)5-6;1-3-5-4-2/h2-5,8H,1H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;3-methylbenzenethiol?
N-ethylethanamine;3-methylbenzenethiol has a molecular weight of 197.35 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;3-methylbenzenethiol is sourced from PubChem (CID 142944401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).