C12H22F2N2 — CID 142944403
N'-[(2Z,4E)-4-(difluoromethyl)hepta-2,4-dienyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 142944403) has the molecular formula C12H22F2N2 and a molecular weight of 232.32 g/mol. Its IUPAC name is N'-[(2Z,4E)-4-(difluoromethyl)hepta-2,4-dienyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(2Z,4E)-4-(difluoromethyl)hepta-2,4-dienyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142944403 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | N'-[(2Z,4E)-4-(difluoromethyl)hepta-2,4-dienyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CC/C=C(\C=C/CN(C)CCNC)C(F)F |
| InChI | InChI=1S/C12H22F2N2/c1-4-6-11(12(13)14)7-5-9-16(3)10-8-15-2/h5-7,12,15H,4,8-10H2,1-3H3/b7-5-,11-6+ |
| InChIKey | YBXIEQDHGQPPQI-LAVHUSFLSA-N |
| XLogP | 2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|