C28H31F6NO6 — CID 142945253
ethyl 4-[1-acetyloxy-2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 142945253) has the molecular formula C28H31F6NO6 and a molecular weight of 591.55 g/mol. Its IUPAC name is ethyl 4-[1-acetyloxy-2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | ethyl 4-[1-acetyloxy-2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 142945253 |
| Molecular Formula | C28H31F6NO6 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | ethyl 4-[1-acetyloxy-2-[4,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2cc(OC)c(OC)cc2C(C(CC2=CCC(C(F)(F)F)=CC(C(F)(F)F)=C2)OC(C)=O)CC1C |
| InChI | InChI=1S/C28H31F6NO6/c1-6-40-26(37)35-15(2)9-21(20-13-24(38-4)25(39-5)14-22(20)35)23(41-16(3)36)11-17-7-8-18(27(29,30)31)12-19(10-17)28(32,33)34/h7,10,12-15,21,23H,6,8-9,11H2,1-5H3 |
| InChIKey | YHPCDNIOZPFWHB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |