C10H19NO — CID 142945371
3-but-2-en-2-yl-2,6-dimethylmorpholine (PubChem CID 142945371) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 3-but-2-en-2-yl-2,6-dimethylmorpholine.
| Compound Name | 3-but-2-en-2-yl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 142945371 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 3-but-2-en-2-yl-2,6-dimethylmorpholine |
| SMILES | CC=C(C)C1NCC(C)OC1C |
| InChI | InChI=1S/C10H19NO/c1-5-7(2)10-9(4)12-8(3)6-11-10/h5,8-11H,6H2,1-4H3 |
| InChIKey | QAZKGBIBUKVKON-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|