C19H36N2 — CID 142945532
(Z,5Z)-5-ethylidene-N,N',N',6-tetramethyl-2-methylidene-N-propylnon-3-ene-1,9-diamine (PubChem CID 142945532) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is (Z,5Z)-5-ethylidene-N,N',N',6-tetramethyl-2-methylidene-N-propylnon-3-ene-1,9-diamine.
| Compound Name | (Z,5Z)-5-ethylidene-N,N',N',6-tetramethyl-2-methylidene-N-propylnon-3-ene-1,9-diamine |
|---|---|
| PubChem CID | 142945532 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | (Z,5Z)-5-ethylidene-N,N',N',6-tetramethyl-2-methylidene-N-propylnon-3-ene-1,9-diamine |
| SMILES | C=C(/C=C\C(=C/C)C(C)CCCN(C)C)CN(C)CCC |
| InChI | InChI=1S/C19H36N2/c1-8-14-21(7)16-17(3)12-13-19(9-2)18(4)11-10-15-20(5)6/h9,12-13,18H,3,8,10-11,14-16H2,1-2,4-7H3/b13-12-,19-9+ |
| InChIKey | DIPMOBYLRZWXCX-YRLMKZJQSA-N |
| XLogP | 4.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|