C6H10F3N4+ — CID 142945735
4-(2,2,2-trifluoroethanimidoyl)-1,2,3,6-tetrahydropyrazin-4-ium-5-amine (PubChem CID 142945735) has the molecular formula C6H10F3N4+ and a molecular weight of 195.17 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethanimidoyl)-1,2,3,6-tetrahydropyrazin-4-ium-5-amine.
| Compound Name | 4-(2,2,2-trifluoroethanimidoyl)-1,2,3,6-tetrahydropyrazin-4-ium-5-amine |
|---|---|
| PubChem CID | 142945735 |
| Molecular Formula | C6H10F3N4+ |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-(2,2,2-trifluoroethanimidoyl)-1,2,3,6-tetrahydropyrazin-4-ium-5-amine |
| SMILES | [H]/N=C(/[N+]1=C(N)CNCC1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N4/c7-6(8,9)5(11)13-2-1-12-3-4(13)10/h10-12H,1-3H2/p+1/b11-5+ |
| InChIKey | LFEJSQGGOYZEFY-VZUCSPMQSA-O |
| XLogP | -0.50 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|