C24H34O3 — CID 142945950
(3R,3aS)-6-ethyl-7-[(2E)-2-(3-methoxycyclohex-2-en-1-ylidene)ethyl]-3a-methylspiro[2,4,7,7a-tetrahydro-1H-indene-3,5'-oxolane]-2'-one (PubChem CID 142945950) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (3R,3aS)-6-ethyl-7-[(2E)-2-(3-methoxycyclohex-2-en-1-ylidene)ethyl]-3a-methylspiro[2,4,7,7a-tetrahydro-1H-indene-3,5'-oxolane]-2'-one.
| Compound Name | (3R,3aS)-6-ethyl-7-[(2E)-2-(3-methoxycyclohex-2-en-1-ylidene)ethyl]-3a-methylspiro[2,4,7,7a-tetrahydro-1H-indene-3,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 142945950 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (3R,3aS)-6-ethyl-7-[(2E)-2-(3-methoxycyclohex-2-en-1-ylidene)ethyl]-3a-methylspiro[2,4,7,7a-tetrahydro-1H-indene-3,5'-oxolane]-2'-one |
| SMILES | CCC1=CC[C@@]2(C)C(CC[C@@]23CCC(=O)O3)C1C/C=C1/C=C(OC)CCC1 |
| InChI | InChI=1S/C24H34O3/c1-4-18-10-13-23(2)21(11-14-24(23)15-12-22(25)27-24)20(18)9-8-17-6-5-7-19(16-17)26-3/h8,10,16,20-21H,4-7,9,11-15H2,1-3H3/b17-8+/t20?,21?,23-,24+/m0/s1 |
| InChIKey | MLOBXCDPJPPAEF-BJYNLSNYSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|