About acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine
acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine (PubChem CID 142946156) has the molecular formula C16H34N2O
and a molecular weight of 270.46 g/mol. Its IUPAC name is acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine.
Molecular Properties
| Compound Name | acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine |
| PubChem CID | 142946156 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine |
| SMILES | CC=O.CCCCNCC[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C14H30N2.C2H4O/c1-2-3-10-16-11-9-14(15)12-13-7-5-4-6-8-13;1-2-3/h13-14,16H,2-12,15H2,1H3;2H,1H3/t14-;/m1./s1 |
| InChIKey | YQDRHOOHEAFIOS-PFEQFJNWSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine?
The IUPAC name of acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine (CID 142946156) is acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine.
What is the SMILES notation for acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine?
The canonical SMILES for acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine is CC=O.CCCCNCC[C@@H](N)CC1CCCCC1.
What is the InChIKey of acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine?
The InChIKey is YQDRHOOHEAFIOS-PFEQFJNWSA-N. The full InChI is InChI=1S/C14H30N2.C2H4O/c1-2-3-10-16-11-9-14(15)12-13-7-5-4-6-8-13;1-2-3/h13-14,16H,2-12,15H2,1H3;2H,1H3/t14-;/m1./s1.
What are the key properties of acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine?
acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine has a molecular weight of 270.46 g/mol, XLogP of 3.27, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;(3S)-1-N-butyl-4-cyclohexylbutane-1,3-diamine is sourced from PubChem (CID 142946156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).