C11H10N2O2S — CID 14294670
7,11-dimethyl-3-thia-7,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-10-carboxylic acid (PubChem CID 14294670) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 7,11-dimethyl-3-thia-7,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-10-carboxylic acid.
| Compound Name | 7,11-dimethyl-3-thia-7,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-10-carboxylic acid |
|---|---|
| PubChem CID | 14294670 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 7,11-dimethyl-3-thia-7,11-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-10-carboxylic acid |
| SMILES | Cn1c(C(=O)O)cc2c1c1sccc1n2C |
| InChI | InChI=1S/C11H10N2O2S/c1-12-6-3-4-16-10(6)9-7(12)5-8(11(14)15)13(9)2/h3-5H,1-2H3,(H,14,15) |
| InChIKey | MGNSKAHFMIYOBA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |