About 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol
2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol (PubChem CID 142946905) has the molecular formula C15H19BrN2O
and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol.
Molecular Properties
| Compound Name | 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol |
| PubChem CID | 142946905 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol |
| SMILES | C/C=C\Cn1cnc2cc(CO)ccc21.C=C(C)Br |
| InChI | InChI=1S/C12H14N2O.C3H5Br/c1-2-3-6-14-9-13-11-7-10(8-15)4-5-12(11)14;1-3(2)4/h2-5,7,9,15H,6,8H2,1H3;1H2,2H3/b3-2-; |
| InChIKey | MTFBVFGEGVWFJN-OLGQORCHSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol?
The IUPAC name of 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol (CID 142946905) is 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol.
What is the SMILES notation for 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol?
The canonical SMILES for 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol is C/C=C\Cn1cnc2cc(CO)ccc21.C=C(C)Br.
What is the InChIKey of 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol?
The InChIKey is MTFBVFGEGVWFJN-OLGQORCHSA-N. The full InChI is InChI=1S/C12H14N2O.C3H5Br/c1-2-3-6-14-9-13-11-7-10(8-15)4-5-12(11)14;1-3(2)4/h2-5,7,9,15H,6,8H2,1H3;1H2,2H3/b3-2-;.
What are the key properties of 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol?
2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol has a molecular weight of 323.23 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoprop-1-ene;[1-[(Z)-but-2-enyl]benzimidazol-5-yl]methanol is sourced from PubChem (CID 142946905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).