C17H20N6S — CID 142946996
3-cyclopropyl-7-N-[4-(dimethylaminosulfanyl)phenyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine (PubChem CID 142946996) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-cyclopropyl-7-N-[4-(dimethylaminosulfanyl)phenyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine.
| Compound Name | 3-cyclopropyl-7-N-[4-(dimethylaminosulfanyl)phenyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 142946996 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-cyclopropyl-7-N-[4-(dimethylaminosulfanyl)phenyl]pyrazolo[1,5-a]pyrimidine-5,7-diamine |
| SMILES | CN(C)Sc1ccc(Nc2cc(N)nc3c(C4CC4)cnn23)cc1 |
| InChI | InChI=1S/C17H20N6S/c1-22(2)24-13-7-5-12(6-8-13)20-16-9-15(18)21-17-14(11-3-4-11)10-19-23(16)17/h5-11,20H,3-4H2,1-2H3,(H2,18,21) |
| InChIKey | JQFHITHKZGWFGJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|