C26H37N5S — CID 142948279
N-[[5-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-ethylthiophen-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 142948279) has the molecular formula C26H37N5S and a molecular weight of 451.68 g/mol. Its IUPAC name is N-[[5-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-ethylthiophen-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[5-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-ethylthiophen-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142948279 |
| Molecular Formula | C26H37N5S |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | N-[[5-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-ethylthiophen-3-yl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCc1c(CNCCCN(CC)CC)csc1-c1ccnc(Nc2cc(C)cc(C)c2)n1 |
| InChI | InChI=1S/C26H37N5S/c1-6-23-21(17-27-11-9-13-31(7-2)8-3)18-32-25(23)24-10-12-28-26(30-24)29-22-15-19(4)14-20(5)16-22/h10,12,14-16,18,27H,6-9,11,13,17H2,1-5H3,(H,28,29,30) |
| InChIKey | WIXUXCCCFMYZGA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|