C18H17N3O5 — CID 14294847
2,2-dimethyl-5-[[(5-phenylmethoxypyrimidin-4-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 14294847) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(5-phenylmethoxypyrimidin-4-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(5-phenylmethoxypyrimidin-4-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14294847 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2,2-dimethyl-5-[[(5-phenylmethoxypyrimidin-4-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ncncc2OCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C18H17N3O5/c1-18(2)25-16(22)13(17(23)26-18)8-20-15-14(9-19-11-21-15)24-10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,19,20,21) |
| InChIKey | PDMIBWOIRXYSNL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|