About N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide
N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide (PubChem CID 142949248) has the molecular formula C15H31N3O3
and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide.
Molecular Properties
| Compound Name | N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide |
| PubChem CID | 142949248 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCCOCCOCCN1CC(C)C(C)C1 |
| InChI | InChI=1S/C15H31N3O3/c1-13-11-18(12-14(13)2)5-7-21-9-8-20-6-4-17-15(19)10-16-3/h13-14,16H,4-12H2,1-3H3,(H,17,19) |
| InChIKey | UPFXZJOABIDONQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide?
The IUPAC name of N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide (CID 142949248) is N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide.
What is the SMILES notation for N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide?
The canonical SMILES for N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide is CNCC(=O)NCCOCCOCCN1CC(C)C(C)C1.
What is the InChIKey of N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide?
The InChIKey is UPFXZJOABIDONQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O3/c1-13-11-18(12-14(13)2)5-7-21-9-8-20-6-4-17-15(19)10-16-3/h13-14,16H,4-12H2,1-3H3,(H,17,19).
What are the key properties of N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide?
N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide has a molecular weight of 301.43 g/mol, XLogP of -0.06, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]-2-(methylamino)acetamide is sourced from PubChem (CID 142949248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).