About tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate
tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142949251) has the molecular formula C17H34N2O4
and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate |
| PubChem CID | 142949251 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC1CN(CCOCCOCCNC(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C17H34N2O4/c1-14-12-19(13-15(14)2)7-9-22-11-10-21-8-6-18-16(20)23-17(3,4)5/h14-15H,6-13H2,1-5H3,(H,18,20) |
| InChIKey | WVSOGAKHRIYFHS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate (CID 142949251) is tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate is CC1CN(CCOCCOCCNC(=O)OC(C)(C)C)CC1C.
What is the InChIKey of tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate?
The InChIKey is WVSOGAKHRIYFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O4/c1-14-12-19(13-15(14)2)7-9-22-11-10-21-8-6-18-16(20)23-17(3,4)5/h14-15H,6-13H2,1-5H3,(H,18,20).
What are the key properties of tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate?
tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate has a molecular weight of 330.47 g/mol, XLogP of 2.13, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[2-[2-(3,4-dimethylpyrrolidin-1-yl)ethoxy]ethoxy]ethyl]carbamate is sourced from PubChem (CID 142949251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).