C16H24OSi — CID 14295014
1-(4-methyl-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone (PubChem CID 14295014) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is 1-(4-methyl-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone.
| Compound Name | 1-(4-methyl-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 14295014 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(4-methyl-3-trimethylsilyl-5,6,7,8-tetrahydronaphthalen-1-yl)ethanone |
| SMILES | CC(=O)c1cc([Si](C)(C)C)c(C)c2c1CCCC2 |
| InChI | InChI=1S/C16H24OSi/c1-11-13-8-6-7-9-14(13)15(12(2)17)10-16(11)18(3,4)5/h10H,6-9H2,1-5H3 |
| InChIKey | MMBFNTZRQDQMKA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|