C17H26OSi — CID 14295015
1-(1-methyl-2-trimethylsilyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)ethanone (PubChem CID 14295015) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is 1-(1-methyl-2-trimethylsilyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)ethanone.
| Compound Name | 1-(1-methyl-2-trimethylsilyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)ethanone |
|---|---|
| PubChem CID | 14295015 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1-(1-methyl-2-trimethylsilyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-4-yl)ethanone |
| SMILES | CC(=O)c1cc([Si](C)(C)C)c(C)c2c1CCCCC2 |
| InChI | InChI=1S/C17H26OSi/c1-12-14-9-7-6-8-10-15(14)16(13(2)18)11-17(12)19(3,4)5/h11H,6-10H2,1-5H3 |
| InChIKey | XTKGYTLPGUUQTQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|