C16H25NO3 — CID 142950436
4-[(2E)-2-ethylidene-5-oxopyrrolidin-1-yl]cyclohexane-1-carboxylic acid;prop-1-ene (PubChem CID 142950436) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-[(2E)-2-ethylidene-5-oxopyrrolidin-1-yl]cyclohexane-1-carboxylic acid;prop-1-ene.
| Compound Name | 4-[(2E)-2-ethylidene-5-oxopyrrolidin-1-yl]cyclohexane-1-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 142950436 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 4-[(2E)-2-ethylidene-5-oxopyrrolidin-1-yl]cyclohexane-1-carboxylic acid;prop-1-ene |
| SMILES | C/C=C1\CCC(=O)N1C1CCC(C(=O)O)CC1.C=CC |
| InChI | InChI=1S/C13H19NO3.C3H6/c1-2-10-7-8-12(15)14(10)11-5-3-9(4-6-11)13(16)17;1-3-2/h2,9,11H,3-8H2,1H3,(H,16,17);3H,1H2,2H3/b10-2+; |
| InChIKey | UQAGQQJKXXQEDS-JVSGEUHRSA-N |
| XLogP | 3.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|