About (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid
(4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid (PubChem CID 142950860) has the molecular formula C15H20F2NO2+
and a molecular weight of 284.33 g/mol. Its IUPAC name is (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid |
| PubChem CID | 142950860 |
| Molecular Formula | C15H20F2NO2+ |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid |
| SMILES | CC(C)(C)[NH+]1CC(C(=O)O)[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H19F2NO2/c1-15(2,3)18-7-11(12(8-18)14(19)20)10-5-4-9(16)6-13(10)17/h4-6,11-12H,7-8H2,1-3H3,(H,19,20)/p+1/t11-,12?/m0/s1 |
| InChIKey | VREKTDQOMSTPDN-PXYINDEMSA-O |
| XLogP | 1.45 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid?
The IUPAC name of (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid (CID 142950860) is (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid.
What is the SMILES notation for (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid?
The canonical SMILES for (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid is CC(C)(C)[NH+]1CC(C(=O)O)[C@H](c2ccc(F)cc2F)C1.
What is the InChIKey of (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid?
The InChIKey is VREKTDQOMSTPDN-PXYINDEMSA-O. The full InChI is InChI=1S/C15H19F2NO2/c1-15(2,3)18-7-11(12(8-18)14(19)20)10-5-4-9(16)6-13(10)17/h4-6,11-12H,7-8H2,1-3H3,(H,19,20)/p+1/t11-,12?/m0/s1.
What are the key properties of (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid?
(4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid has a molecular weight of 284.33 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidin-1-ium-3-carboxylic acid is sourced from PubChem (CID 142950860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).