C15H25F2N — CID 142950915
(4E)-N-tert-butyl-N-ethyl-4,6-difluoro-2-methyl-3-methylidenehepta-4,6-dien-1-amine (PubChem CID 142950915) has the molecular formula C15H25F2N and a molecular weight of 257.37 g/mol. Its IUPAC name is (4E)-N-tert-butyl-N-ethyl-4,6-difluoro-2-methyl-3-methylidenehepta-4,6-dien-1-amine.
| Compound Name | (4E)-N-tert-butyl-N-ethyl-4,6-difluoro-2-methyl-3-methylidenehepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 142950915 |
| Molecular Formula | C15H25F2N |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | (4E)-N-tert-butyl-N-ethyl-4,6-difluoro-2-methyl-3-methylidenehepta-4,6-dien-1-amine |
| SMILES | C=C(F)/C=C(/F)C(=C)C(C)CN(CC)C(C)(C)C |
| InChI | InChI=1S/C15H25F2N/c1-8-18(15(5,6)7)10-11(2)13(4)14(17)9-12(3)16/h9,11H,3-4,8,10H2,1-2,5-7H3/b14-9+ |
| InChIKey | KGZWYXSQQAYUTF-NTEUORMPSA-N |
| XLogP | 4.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|