C14H20O4 — CID 142951001
methyl (1R)-7-hydroxy-4,11-dimethyl-8-oxatricyclo[5.3.1.04,11]undec-2-ene-10-carboxylate (PubChem CID 142951001) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (1R)-7-hydroxy-4,11-dimethyl-8-oxatricyclo[5.3.1.04,11]undec-2-ene-10-carboxylate.
| Compound Name | methyl (1R)-7-hydroxy-4,11-dimethyl-8-oxatricyclo[5.3.1.04,11]undec-2-ene-10-carboxylate |
|---|---|
| PubChem CID | 142951001 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl (1R)-7-hydroxy-4,11-dimethyl-8-oxatricyclo[5.3.1.04,11]undec-2-ene-10-carboxylate |
| SMILES | COC(=O)C1COC2(O)CCC3(C)C=C[C@H]1C32C |
| InChI | InChI=1S/C14H20O4/c1-12-5-4-10-9(11(15)17-3)8-18-14(16,7-6-12)13(10,12)2/h4-5,9-10,16H,6-8H2,1-3H3/t9?,10-,12?,13?,14?/m1/s1 |
| InChIKey | QSXYTOKBERCWLO-HYKZHAOISA-N |
| XLogP | 1.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|