C18H20F3N5O2 — CID 142951066
1-N-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-yl]-4-N-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 142951066) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-N-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-yl]-4-N-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-yl]-4-N-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 142951066 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-N-[6-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)pyrimidin-4-yl]-4-N-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | FC(F)(F)Nc1ccc(Nc2cc(N3CCC4(CC3)OCCO4)ncn2)cc1 |
| InChI | InChI=1S/C18H20F3N5O2/c19-18(20,21)25-14-3-1-13(2-4-14)24-15-11-16(23-12-22-15)26-7-5-17(6-8-26)27-9-10-28-17/h1-4,11-12,25H,5-10H2,(H,22,23,24) |
| InChIKey | GQPVTSLRFJZDMX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|