About ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine
ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine (PubChem CID 142951523) has the molecular formula C7H19N3
and a molecular weight of 145.25 g/mol. Its IUPAC name is ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine.
Molecular Properties
| Compound Name | ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine |
| PubChem CID | 142951523 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine |
| SMILES | CC.CN/C=C(\N)CCN |
| InChI | InChI=1S/C5H13N3.C2H6/c1-8-4-5(7)2-3-6;1-2/h4,8H,2-3,6-7H2,1H3;1-2H3/b5-4-; |
| InChIKey | QBKLGEBDKIOFLB-MKWAYWHRSA-N |
| XLogP | 0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine?
The IUPAC name of ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine (CID 142951523) is ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine.
What is the SMILES notation for ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine?
The canonical SMILES for ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine is CC.CN/C=C(\N)CCN.
What is the InChIKey of ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine?
The InChIKey is QBKLGEBDKIOFLB-MKWAYWHRSA-N. The full InChI is InChI=1S/C5H13N3.C2H6/c1-8-4-5(7)2-3-6;1-2/h4,8H,2-3,6-7H2,1H3;1-2H3/b5-4-;.
What are the key properties of ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine?
ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine has a molecular weight of 145.25 g/mol, XLogP of 0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine is sourced from PubChem (CID 142951523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).