C7H19N3 — CID 142951523
ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine (PubChem CID 142951523) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine.
| Compound Name | ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine |
|---|---|
| PubChem CID | 142951523 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | ethane;(Z)-1-N-methylbut-1-ene-1,2,4-triamine |
| SMILES | CC.CN/C=C(\N)CCN |
| InChI | InChI=1S/C5H13N3.C2H6/c1-8-4-5(7)2-3-6;1-2/h4,8H,2-3,6-7H2,1H3;1-2H3/b5-4-; |
| InChIKey | QBKLGEBDKIOFLB-MKWAYWHRSA-N |
| XLogP | 0.38 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |