About chloromethyl propan-2-yl carbonate;propan-2-ol
chloromethyl propan-2-yl carbonate;propan-2-ol (PubChem CID 142952543) has the molecular formula C8H17ClO4
and a molecular weight of 212.67 g/mol. Its IUPAC name is chloromethyl propan-2-yl carbonate;propan-2-ol.
Molecular Properties
| Compound Name | chloromethyl propan-2-yl carbonate;propan-2-ol |
| PubChem CID | 142952543 |
| Molecular Formula | C8H17ClO4 |
| Molecular Weight | 212.67 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | chloromethyl propan-2-yl carbonate;propan-2-ol |
| SMILES | CC(C)O.CC(C)OC(=O)OCCl |
| InChI | InChI=1S/C5H9ClO3.C3H8O/c1-4(2)9-5(7)8-3-6;1-3(2)4/h4H,3H2,1-2H3;3-4H,1-2H3 |
| InChIKey | XUVQSWLBYRZRLA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl propan-2-yl carbonate;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl propan-2-yl carbonate;propan-2-ol?
The IUPAC name of chloromethyl propan-2-yl carbonate;propan-2-ol (CID 142952543) is chloromethyl propan-2-yl carbonate;propan-2-ol.
What is the SMILES notation for chloromethyl propan-2-yl carbonate;propan-2-ol?
The canonical SMILES for chloromethyl propan-2-yl carbonate;propan-2-ol is CC(C)O.CC(C)OC(=O)OCCl.
What is the InChIKey of chloromethyl propan-2-yl carbonate;propan-2-ol?
The InChIKey is XUVQSWLBYRZRLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO3.C3H8O/c1-4(2)9-5(7)8-3-6;1-3(2)4/h4H,3H2,1-2H3;3-4H,1-2H3.
What are the key properties of chloromethyl propan-2-yl carbonate;propan-2-ol?
chloromethyl propan-2-yl carbonate;propan-2-ol has a molecular weight of 212.67 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl propan-2-yl carbonate;propan-2-ol is sourced from PubChem (CID 142952543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).