About (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one
(6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one (PubChem CID 142952671) has the molecular formula C15H19F2NOS
and a molecular weight of 299.39 g/mol. Its IUPAC name is (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one.
Molecular Properties
| Compound Name | (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one |
| PubChem CID | 142952671 |
| Molecular Formula | C15H19F2NOS |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one |
| SMILES | CSCCN1C[C@H](c2cccc(F)c2F)CCCC1=O |
| InChI | InChI=1S/C15H19F2NOS/c1-20-9-8-18-10-11(4-2-7-14(18)19)12-5-3-6-13(16)15(12)17/h3,5-6,11H,2,4,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | VLKPAMLMJVEFPC-LLVKDONJSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one?
The IUPAC name of (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one (CID 142952671) is (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one.
What is the SMILES notation for (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one?
The canonical SMILES for (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one is CSCCN1C[C@H](c2cccc(F)c2F)CCCC1=O.
What is the InChIKey of (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one?
The InChIKey is VLKPAMLMJVEFPC-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19F2NOS/c1-20-9-8-18-10-11(4-2-7-14(18)19)12-5-3-6-13(16)15(12)17/h3,5-6,11H,2,4,7-10H2,1H3/t11-/m1/s1.
What are the key properties of (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one?
(6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one has a molecular weight of 299.39 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-6-(2,3-difluorophenyl)-1-(2-methylsulfanylethyl)azepan-2-one is sourced from PubChem (CID 142952671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).