C22H22F2N4O2 — CID 142952696
phenyl N-cyano-N-[(3R,6S)-6-(2,3-difluorophenyl)-1-ethyl-2-oxoazepan-3-yl]carbamimidate (PubChem CID 142952696) has the molecular formula C22H22F2N4O2 and a molecular weight of 412.44 g/mol. Its IUPAC name is phenyl N-cyano-N-[(3R,6S)-6-(2,3-difluorophenyl)-1-ethyl-2-oxoazepan-3-yl]carbamimidate.
| Compound Name | phenyl N-cyano-N-[(3R,6S)-6-(2,3-difluorophenyl)-1-ethyl-2-oxoazepan-3-yl]carbamimidate |
|---|---|
| PubChem CID | 142952696 |
| Molecular Formula | C22H22F2N4O2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | phenyl N-cyano-N-[(3R,6S)-6-(2,3-difluorophenyl)-1-ethyl-2-oxoazepan-3-yl]carbamimidate |
| SMILES | [H]/N=C(\Oc1ccccc1)N(C#N)[C@@H]1CC[C@@H](c2cccc(F)c2F)CN(CC)C1=O |
| InChI | InChI=1S/C22H22F2N4O2/c1-2-27-13-15(17-9-6-10-18(23)20(17)24)11-12-19(21(27)29)28(14-25)22(26)30-16-7-4-3-5-8-16/h3-10,15,19,26H,2,11-13H2,1H3/b26-22-/t15-,19-/m1/s1 |
| InChIKey | XRWCQDDYWLDBBD-VUMIZEOLSA-N |
| XLogP | 3.86 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|