C25H35N7O8 — CID 142953192
2-[[3-[[(2S)-1-[2-[[3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid (PubChem CID 142953192) has the molecular formula C25H35N7O8 and a molecular weight of 561.60 g/mol. Its IUPAC name is 2-[[3-[[(2S)-1-[2-[[3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[(2S)-1-[2-[[3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 142953192 |
| Molecular Formula | C25H35N7O8 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-[[3-[[(2S)-1-[2-[[3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
| SMILES | CCCC(NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)C(NC(=O)c1cnccn1)C(C)C)C(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C25H35N7O8/c1-4-6-15(21(36)25(40)29-13-19(34)35)30-23(38)17-7-5-10-32(17)18(33)12-28-24(39)20(14(2)3)31-22(37)16-11-26-8-9-27-16/h8-9,11,14-15,17,20H,4-7,10,12-13H2,1-3H3,(H,28,39)(H,29,40)(H,30,38)(H,31,37)(H,34,35)/t15?,17-,20?/m0/s1 |
| InChIKey | KISDIAWPPGBCHL-CMVHYPBASA-N |
| XLogP | -1.61 |
| TPSA | 216.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|