About N-ethyl-2,3-bis(methylimino)propanamide
N-ethyl-2,3-bis(methylimino)propanamide (PubChem CID 142953206) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-ethyl-2,3-bis(methylimino)propanamide.
Molecular Properties
| Compound Name | N-ethyl-2,3-bis(methylimino)propanamide |
| PubChem CID | 142953206 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-ethyl-2,3-bis(methylimino)propanamide |
| SMILES | CCNC(=O)C(/C=N/C)=N/C |
| InChI | InChI=1S/C7H13N3O/c1-4-10-7(11)6(9-3)5-8-2/h5H,4H2,1-3H3,(H,10,11)/b8-5+,9-6+ |
| InChIKey | NTKFRBXLITWOEX-XVYDYJIPSA-N |
| XLogP | -0.11 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,3-bis(methylimino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-bis(methylimino)propanamide?
The IUPAC name of N-ethyl-2,3-bis(methylimino)propanamide (CID 142953206) is N-ethyl-2,3-bis(methylimino)propanamide.
What is the SMILES notation for N-ethyl-2,3-bis(methylimino)propanamide?
The canonical SMILES for N-ethyl-2,3-bis(methylimino)propanamide is CCNC(=O)C(/C=N/C)=N/C.
What is the InChIKey of N-ethyl-2,3-bis(methylimino)propanamide?
The InChIKey is NTKFRBXLITWOEX-XVYDYJIPSA-N. The full InChI is InChI=1S/C7H13N3O/c1-4-10-7(11)6(9-3)5-8-2/h5H,4H2,1-3H3,(H,10,11)/b8-5+,9-6+.
What are the key properties of N-ethyl-2,3-bis(methylimino)propanamide?
N-ethyl-2,3-bis(methylimino)propanamide has a molecular weight of 155.20 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-bis(methylimino)propanamide is sourced from PubChem (CID 142953206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).