C21H20ClN5O2 — CID 142953268
N-[6-chloro-7-[2-(methylamino)ethoxy]-9H-pyrido[3,4-b]indol-8-yl]-2-methylpyridine-3-carboxamide (PubChem CID 142953268) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N-[6-chloro-7-[2-(methylamino)ethoxy]-9H-pyrido[3,4-b]indol-8-yl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[6-chloro-7-[2-(methylamino)ethoxy]-9H-pyrido[3,4-b]indol-8-yl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 142953268 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[6-chloro-7-[2-(methylamino)ethoxy]-9H-pyrido[3,4-b]indol-8-yl]-2-methylpyridine-3-carboxamide |
| SMILES | CNCCOc1c(Cl)cc2c([nH]c3cnccc32)c1NC(=O)c1cccnc1C |
| InChI | InChI=1S/C21H20ClN5O2/c1-12-13(4-3-6-25-12)21(28)27-19-18-15(14-5-7-24-11-17(14)26-18)10-16(22)20(19)29-9-8-23-2/h3-7,10-11,23,26H,8-9H2,1-2H3,(H,27,28) |
| InChIKey | WWOCTCAYKSAUGS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|