C32H36O16P4 — CID 14295338
[25,26,27,28-tetrahydroxy-11,17,23-tris(phosphonomethyl)-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]methylphosphonic acid (PubChem CID 14295338) has the molecular formula C32H36O16P4 and a molecular weight of 800.52 g/mol. Its IUPAC name is [25,26,27,28-tetrahydroxy-11,17,23-tris(phosphonomethyl)-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]methylphosphonic acid.
| Compound Name | [25,26,27,28-tetrahydroxy-11,17,23-tris(phosphonomethyl)-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 14295338 |
| Molecular Formula | C32H36O16P4 |
| Molecular Weight | 800.52 g/mol |
| Exact Mass | 800.10 |
| IUPAC Name | [25,26,27,28-tetrahydroxy-11,17,23-tris(phosphonomethyl)-5-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1cc2c(O)c(c1)Cc1cc(CP(=O)(O)O)cc(c1O)Cc1cc(CP(=O)(O)O)cc(c1O)Cc1cc(CP(=O)(O)O)cc(c1O)C2 |
| InChI | InChI=1S/C32H36O16P4/c33-29-21-1-17(13-49(37,38)39)2-22(29)10-24-5-19(15-51(43,44)45)6-27(31(24)35)12-28-8-20(16-52(46,47)48)7-26(32(28)36)11-25-4-18(14-50(40,41)42)3-23(9-21)30(25)34/h1-8,33-36H,9-16H2,(H2,37,38,39)(H2,40,41,42)(H2,43,44,45)(H2,46,47,48) |
| InChIKey | HXGDFDVLRPRMJW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 311.04 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|