C14H23F2N — CID 142953906
1-tert-butyl-3-[(2Z,4E)-1,5-difluorohexa-2,4-dien-2-yl]pyrrolidine (PubChem CID 142953906) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2Z,4E)-1,5-difluorohexa-2,4-dien-2-yl]pyrrolidine.
| Compound Name | 1-tert-butyl-3-[(2Z,4E)-1,5-difluorohexa-2,4-dien-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 142953906 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-tert-butyl-3-[(2Z,4E)-1,5-difluorohexa-2,4-dien-2-yl]pyrrolidine |
| SMILES | C/C(F)=C\C=C(/CF)C1CCN(C(C)(C)C)C1 |
| InChI | InChI=1S/C14H23F2N/c1-11(16)5-6-12(9-15)13-7-8-17(10-13)14(2,3)4/h5-6,13H,7-10H2,1-4H3/b11-5+,12-6+ |
| InChIKey | GOYVLARWDIVZLD-YDWXAUTNSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|