About 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol
2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol (PubChem CID 14295443) has the molecular formula C10H18O2S3
and a molecular weight of 266.45 g/mol. Its IUPAC name is 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol.
Molecular Properties
| Compound Name | 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol |
| PubChem CID | 14295443 |
| Molecular Formula | C10H18O2S3 |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol |
| SMILES | CSC1(C2(O)CCCCO2)SCCCS1 |
| InChI | InChI=1S/C10H18O2S3/c1-13-10(14-7-4-8-15-10)9(11)5-2-3-6-12-9/h11H,2-8H2,1H3 |
| InChIKey | PBBOAIDSFQQNFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol?
The IUPAC name of 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol (CID 14295443) is 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol.
What is the SMILES notation for 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol?
The canonical SMILES for 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol is CSC1(C2(O)CCCCO2)SCCCS1.
What is the InChIKey of 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol?
The InChIKey is PBBOAIDSFQQNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2S3/c1-13-10(14-7-4-8-15-10)9(11)5-2-3-6-12-9/h11H,2-8H2,1H3.
What are the key properties of 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol?
2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol has a molecular weight of 266.45 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylsulfanyl-1,3-dithian-2-yl)oxan-2-ol is sourced from PubChem (CID 14295443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).