C31H50O4 — CID 142954516
trans-(1R,3S,5Z)-5-[(2E)-2-[(7aR)-1a-[(1R)-1-(4-hydroxy-4-propylheptoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-cyclopropa[i]inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 142954516) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(2E)-2-[(7aR)-1a-[(1R)-1-(4-hydroxy-4-propylheptoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-cyclopropa[i]inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(2E)-2-[(7aR)-1a-[(1R)-1-(4-hydroxy-4-propylheptoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-cyclopropa[i]inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 142954516 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(2E)-2-[(7aR)-1a-[(1R)-1-(4-hydroxy-4-propylheptoxy)ethyl]-2,3,3a,5,6,7-hexahydro-1H-cyclopropa[i]inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]34CC3([C@@H](C)OCCCC(O)(CCC)CCC)CCC24)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C31H50O4/c1-5-13-29(34,14-6-2)15-8-18-35-23(4)30-17-12-27-24(9-7-16-31(27,30)21-30)10-11-25-19-26(32)20-28(33)22(25)3/h10-11,23,26-28,32-34H,3,5-9,12-21H2,1-2,4H3/b24-10+,25-11-/t23-,26-,27?,28+,30?,31-/m1/s1 |
| InChIKey | SWCCOXNIOVSCPA-WKMKDAQFSA-N |
| XLogP | 6.40 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|